Products 20105-20-8
CAS 20105-20-8 appears in our catalog under these names: Murrastinine C, Murrastinine C. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
3,3-dimethyl-11H-pyrano[3,2-a]carbazole-8-carbaldehyde (CAS 20105-20-8) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 3,3-dimethyl-11H-pyrano[3,2-a]carbazole-8-carbaldehyde. InChIKey: QTXCJUWYNICVSM-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 3,3-dimethyl-11H-pyrano[3,2-a]carbazole-8-carbaldehyde |
| InChIKey | QTXCJUWYNICVSM-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC3=C2NC4=C3C=C(C=C4)C=O)C |
Computed by PubChem (NCBI)
Synonyms:
Murrastinine C, orb1680551