CAS 201156-86-7 appears in our catalog under these names: Fa-pro-oh, 95%, FA-Pro-OH. Offered by: Combi-blocks, Creative Peptides. Available pack sizes: 100mg, 250mg, 1g.
(2S)-1-[(E)-3-(furan-2-yl)prop-2-enoyl]pyrrolidine-2-carboxylic acid (CAS 201156-86-7) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: (2S)-1-[(E)-3-(furan-2-yl)prop-2-enoyl]pyrrolidine-2-carboxylic acid. InChIKey: JQPXLPVJRYDONF-PORFMDCZSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | (2S)-1-[(E)-3-(furan-2-yl)prop-2-enoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JQPXLPVJRYDONF-PORFMDCZSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)/C=C/C2=CC=CO2)C(=O)O |
Computed by PubChem (NCBI)