Products 2012574-78-4
CAS 2012574-78-4 is the registry number for trans-3-{[(tert-butoxy)carbonyl]amino}oxetane-2-carboxylic acid, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetane-2-carboxylic acid (CAS 2012574-78-4) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. IUPAC name: (2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetane-2-carboxylic acid. InChIKey: ZAAGFPCWFSEKCQ-WDSKDSINSA-N.
| Molecular formula | C9H15NO5 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | (2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetane-2-carboxylic acid |
| InChIKey | ZAAGFPCWFSEKCQ-WDSKDSINSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CO[C@@H]1C(=O)O |
Computed by PubChem (NCBI)