CAS 201730-11-2 appears in our catalog under these names: (S)-3,4-DCPG, (S)-3,4-DCPG, 99%, (S)–3,4–DCPG, (S)-3,4-DCPG, 99%, 99%, (S)-3,4-DCPG, 99.9%. Offered by: TRC, AmBeed, GLPBio, TargetMol, Chemat. Available pack sizes: 50mg, 10mg, 1mg, 5mg, 25mg, 100mg, 5 mg.
4-[(S)-amino(carboxy)methyl]phthalic acid (CAS 201730-11-2) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: 4-[(S)-amino(carboxy)methyl]phthalic acid. InChIKey: IJVMOGKBEVRBPP-ZETCQYMHSA-N.
| Molecular formula | C10H9NO6 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | 4-[(S)-amino(carboxy)methyl]phthalic acid |
| InChIKey | IJVMOGKBEVRBPP-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H](C(=O)O)N)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)