CAS 20188-03-8 is the registry number for Diphenyldiazometane. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-diphenyldiazirine (CAS 20188-03-8) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 3,3-diphenyldiazirine. InChIKey: YSIXZOWGRJZVLY-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3,3-diphenyldiazirine |
| InChIKey | YSIXZOWGRJZVLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(N=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)