CAS 20197-84-6 appears in our catalog under these names: 2,4-Dichloro-6,7-dimethylquinazoline, 95%, 2,4-Dichloro-6,7-dimethylquinazoline, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
2,4-dichloro-6,7-dimethyl-1,2,3,4-tetrahydroquinazoline (CAS 20197-84-6) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 2,4-dichloro-6,7-dimethyl-1,2,3,4-tetrahydroquinazoline. InChIKey: LEBBEVDINUHSNX-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 2,4-dichloro-6,7-dimethyl-1,2,3,4-tetrahydroquinazoline |
| InChIKey | LEBBEVDINUHSNX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)NC(NC2Cl)Cl |
Computed by PubChem (NCBI)