CAS 202001-00-1 appears in our catalog under these names: 3–Chloro–5–fluorophenylacetic acid, 2-(3-Chloro-5-fluorophenyl)acetic acid 95%, 2-(3-Chloro-5-fluorophenyl)acetic acid, 95%, 95%, 5-Chloro-3-fluorophenylacetic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 500g, 250mg, 1g, 10g, 100g.
2-(3-chloro-5-fluorophenyl)acetic acid (CAS 202001-00-1) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-(3-chloro-5-fluorophenyl)acetic acid. InChIKey: GFLQMGYDUPLXHZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-(3-chloro-5-fluorophenyl)acetic acid |
| InChIKey | GFLQMGYDUPLXHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)Cl)CC(=O)O |
Computed by PubChem (NCBI)