Products 202114-65-6
CAS 202114-65-6 appears in our catalog under these names: L–Tryptophan–13C11, L-Tryptophan-13C11, 99.60%, L-Tryptophan-13C11, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 5 mg, 1 mg.
(2S)-2-amino-3-(1H-indol-3-yl)(1,2,3-13C3)propanoic acid (CAS 202114-65-6) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 215.15 g/mol. IUPAC name: (2S)-2-amino-3-(1H-indol-3-yl)(1,2,3-13C3)propanoic acid. InChIKey: QIVBCDIJIAJPQS-WQQZOYGJSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 215.15 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-indol-3-yl)(1,2,3-13C3)propanoic acid |
| InChIKey | QIVBCDIJIAJPQS-WQQZOYGJSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]2[13C](=[13CH]1)[13C](=[13CH]N2)[13CH2][13C@@H]([13C](=O)O)N |
Computed by PubChem (NCBI)