Products 2023788-40-9

CAS 2023788-40-9 is the registry number for LT25, 98.73%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg, 10mM/1mL, 50 mg.

Structural formula: {0} (CAS {1})

2-[[2-[1-[(2-methylphenyl)carbamoyl]-4-oxoazetidin-2-yl]acetyl]amino]acetic acid (CAS 2023788-40-9) is a chemical compound with the molecular formula C15H17N3O5 and a molecular weight of 319.31 g/mol. IUPAC name: 2-[[2-[1-[(2-methylphenyl)carbamoyl]-4-oxoazetidin-2-yl]acetyl]amino]acetic acid. InChIKey: HZLFZIQTWBACFC-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17N3O5
Molecular weight319.31 g/mol
IUPAC name2-[[2-[1-[(2-methylphenyl)carbamoyl]-4-oxoazetidin-2-yl]acetyl]amino]acetic acid
InChIKeyHZLFZIQTWBACFC-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1NC(=O)N2C(CC2=O)CC(=O)NCC(=O)O

Computed by PubChem (NCBI)