CAS 2026-08-6 appears in our catalog under these names: Naphthalene-1,8-diyldimethanol, 95%, Naphthalene-1,8-diyldimethanol 95%, Naphthalene-1,8-diyldimethanol, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
[8-(hydroxymethyl)naphthalen-1-yl]methanol (CAS 2026-08-6) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: [8-(hydroxymethyl)naphthalen-1-yl]methanol. InChIKey: DINZUYYYXDLSJE-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | [8-(hydroxymethyl)naphthalen-1-yl]methanol |
| InChIKey | DINZUYYYXDLSJE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)CO)C(=CC=C2)CO |
Computed by PubChem (NCBI)