CAS 2031258-72-5 is the registry number for Methyl 6-chloro-2,3-dihydro-1H-indene-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 6-chloro-2,3-dihydro-1H-indene-5-carboxylate (CAS 2031258-72-5) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: methyl 6-chloro-2,3-dihydro-1H-indene-5-carboxylate. InChIKey: OBTFSSNVQJEERJ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | methyl 6-chloro-2,3-dihydro-1H-indene-5-carboxylate |
| InChIKey | OBTFSSNVQJEERJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C2CCCC2=C1)Cl |
Computed by PubChem (NCBI)