Products 2031258-72-5

CAS 2031258-72-5 is the registry number for Methyl 6-chloro-2,3-dihydro-1H-indene-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 6-chloro-2,3-dihydro-1H-indene-5-carboxylate (CAS 2031258-72-5) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: methyl 6-chloro-2,3-dihydro-1H-indene-5-carboxylate. InChIKey: OBTFSSNVQJEERJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClO2
Molecular weight210.65 g/mol
IUPAC namemethyl 6-chloro-2,3-dihydro-1H-indene-5-carboxylate
InChIKeyOBTFSSNVQJEERJ-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C2CCCC2=C1)Cl

Computed by PubChem (NCBI)