Products 2035422-03-6
CAS 2035422-03-6 is the registry number for rac-(1R,2R)-2-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Trans-(1R,2R)-2-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 2035422-03-6) is a chemical compound with the molecular formula C10H8BrFO2 and a molecular weight of 259.07 g/mol. IUPAC name: trans-(1R,2R)-2-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: UGCIWWFJQQRKOR-NKWVEPMBSA-N.
| Molecular formula | C10H8BrFO2 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | UGCIWWFJQQRKOR-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)