CAS 203645-99-2 is the registry number for Phloroglucinol Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-chlorophenyl)benzene-1,3-diol (CAS 203645-99-2) is a chemical compound with the molecular formula C12H9ClO2 and a molecular weight of 220.65 g/mol. IUPAC name: 5-(4-chlorophenyl)benzene-1,3-diol. InChIKey: FSBFHCZIKJEMAG-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2 |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | 5-(4-chlorophenyl)benzene-1,3-diol |
| InChIKey | FSBFHCZIKJEMAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)O)O)Cl |
Computed by PubChem (NCBI)