CAS 57666-53-2 appears in our catalog under these names: 5-(3-Chloro-4-methylphenyl)-2-furaldehyde, 95%, 5-(3-Chloro-4-methyl-phenyl)-furan-2-carbaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g.
5-(3-chloro-4-methylphenyl)furan-2-carbaldehyde (CAS 57666-53-2) is a chemical compound with the molecular formula C12H9ClO2 and a molecular weight of 220.65 g/mol. IUPAC name: 5-(3-chloro-4-methylphenyl)furan-2-carbaldehyde. InChIKey: OOMPOSIYMXBNCN-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2 |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | 5-(3-chloro-4-methylphenyl)furan-2-carbaldehyde |
| InChIKey | OOMPOSIYMXBNCN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=C(O2)C=O)Cl |
Computed by PubChem (NCBI)