CAS 5471-31-8 is the registry number for Methyl 7-chloro-1-naphthoate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 7-chloronaphthalene-1-carboxylate (CAS 5471-31-8) is a chemical compound with the molecular formula C12H9ClO2 and a molecular weight of 220.65 g/mol. IUPAC name: methyl 7-chloronaphthalene-1-carboxylate. InChIKey: HBTKZIPIAMQOCJ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2 |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | methyl 7-chloronaphthalene-1-carboxylate |
| InChIKey | HBTKZIPIAMQOCJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)