Products 5471-31-8

CAS 5471-31-8 is the registry number for Methyl 7-chloro-1-naphthoate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 7-chloronaphthalene-1-carboxylate (CAS 5471-31-8) is a chemical compound with the molecular formula C12H9ClO2 and a molecular weight of 220.65 g/mol. IUPAC name: methyl 7-chloronaphthalene-1-carboxylate. InChIKey: HBTKZIPIAMQOCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClO2
Molecular weight220.65 g/mol
IUPAC namemethyl 7-chloronaphthalene-1-carboxylate
InChIKeyHBTKZIPIAMQOCJ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC2=C1C=C(C=C2)Cl

Computed by PubChem (NCBI)