Products 54582-59-1
CAS 54582-59-1 appears in our catalog under these names: 2-Chloro-4-phenoxyphenol, 95%, 2-Chloro-4-phenoxyphenol, 98%, 2-Chloro-4-phenoxyphenol 95%, 2-Chloro-4-phenoxyphenol, 95%, 95%, 2-Chloro-4-phenoxyphenol. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-chloro-4-phenoxyphenol (CAS 54582-59-1) is a chemical compound with the molecular formula C12H9ClO2 and a molecular weight of 220.65 g/mol. IUPAC name: 2-chloro-4-phenoxyphenol. InChIKey: OEHWUFIZHYKWIG-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2 |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | 2-chloro-4-phenoxyphenol |
| InChIKey | OEHWUFIZHYKWIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)