CAS 5042-96-6 appears in our catalog under these names: Methyl 6-chloro-2-naphthoate 95%, Methyl 6-chloro-2-naphthoate, 95%, 95%, Nafamostat Impurity 8. Offered by: Ambeed, Chemat, Chemat Brand. Available pack sizes: 100mg, 250mg, 1g, on request.
Methyl 6-chloronaphthalene-2-carboxylate (CAS 5042-96-6) is a chemical compound with the molecular formula C12H9ClO2 and a molecular weight of 220.65 g/mol. IUPAC name: methyl 6-chloronaphthalene-2-carboxylate. InChIKey: FYEHTBMLYNKRSY-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2 |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | methyl 6-chloronaphthalene-2-carboxylate |
| InChIKey | FYEHTBMLYNKRSY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)