CAS 40926-77-0 appears in our catalog under these names: (2-Naphthyloxy)acetyl chloride, 95%, (2-Naphthyloxy)acetyl Chloride, 2-(Naphthalen-2-yloxy)acetyl chloride, 97%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 500mg, 1000mg, 2000mg.
2-naphthalen-2-yloxyacetyl chloride (CAS 40926-77-0) is a chemical compound with the molecular formula C12H9ClO2 and a molecular weight of 220.65 g/mol. IUPAC name: 2-naphthalen-2-yloxyacetyl chloride. InChIKey: PAOBXXMBVWFWMR-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2 |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | 2-naphthalen-2-yloxyacetyl chloride |
| InChIKey | PAOBXXMBVWFWMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)OCC(=O)Cl |
Computed by PubChem (NCBI)