Products 203734-35-4
CAS 203734-35-4 is the registry number for Myrciacetin. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg.
(2S)-2-(2,5-dihydroxyphenyl)-5,7-dihydroxy-6,8-dimethyl-2,3-dihydrochromen-4-one (CAS 203734-35-4) is a chemical compound with the molecular formula C17H16O6 and a molecular weight of 316.30 g/mol. IUPAC name: (2S)-2-(2,5-dihydroxyphenyl)-5,7-dihydroxy-6,8-dimethyl-2,3-dihydrochromen-4-one. InChIKey: DLAILIPOGIKSMK-ZDUSSCGKSA-N.
| Molecular formula | C17H16O6 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | (2S)-2-(2,5-dihydroxyphenyl)-5,7-dihydroxy-6,8-dimethyl-2,3-dihydrochromen-4-one |
| InChIKey | DLAILIPOGIKSMK-ZDUSSCGKSA-N |
| SMILES | CC1=C(C(=C2C(=C1O)C(=O)C[C@H](O2)C3=C(C=CC(=C3)O)O)C)O |
Computed by PubChem (NCBI)