CAS 2039-49-8 is the registry number for 3,5-Diphenylisoxazole, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-diphenyl-1,2-oxazole (CAS 2039-49-8) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 3,5-diphenyl-1,2-oxazole. InChIKey: HECRDSFKLUVCAY-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 3,5-diphenyl-1,2-oxazole |
| InChIKey | HECRDSFKLUVCAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NO2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)