Products 204254-68-2

CAS 204254-68-2 is the registry number for 2-Amino-4-methyl-5-nitrobenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-4-methyl-5-nitrobenzoic acid (CAS 204254-68-2) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 2-amino-4-methyl-5-nitrobenzoic acid. InChIKey: AXFFZRYCZQODAO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N2O4
Molecular weight196.16 g/mol
IUPAC name2-amino-4-methyl-5-nitrobenzoic acid
InChIKeyAXFFZRYCZQODAO-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)N

Computed by PubChem (NCBI)