Products 2043402-33-9
CAS 2043402-33-9 appears in our catalog under these names: 2-(3,5-Diethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(3,5-Diethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-(3,5-diethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2043402-33-9) is a chemical compound with the molecular formula C16H25BO2 and a molecular weight of 260.2 g/mol. IUPAC name: 2-(3,5-diethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NLJFZQSWSQSPJS-UHFFFAOYSA-N.
| Molecular formula | C16H25BO2 |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 2-(3,5-diethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NLJFZQSWSQSPJS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)CC)CC |
Computed by PubChem (NCBI)