CAS 2044705-87-3 is the registry number for rac-1-((1R,2R)-2-Hydroxycyclobutyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 25mg, 0,25g.
1-[(1R,2R)-2-hydroxycyclobutyl]triazole-4-carboxylic acid (CAS 2044705-87-3) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: 1-[(1R,2R)-2-hydroxycyclobutyl]triazole-4-carboxylic acid. InChIKey: IWVIOFLJAJWRNW-PHDIDXHHSA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 1-[(1R,2R)-2-hydroxycyclobutyl]triazole-4-carboxylic acid |
| InChIKey | IWVIOFLJAJWRNW-PHDIDXHHSA-N |
| SMILES | C1C[C@H]([C@@H]1N2C=C(N=N2)C(=O)O)O |
Computed by PubChem (NCBI)