Products 2044705-87-3

CAS 2044705-87-3 is the registry number for rac-1-((1R,2R)-2-Hydroxycyclobutyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 25mg, 0,25g.

Structural formula: {0} (CAS {1})

1-[(1R,2R)-2-hydroxycyclobutyl]triazole-4-carboxylic acid (CAS 2044705-87-3) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: 1-[(1R,2R)-2-hydroxycyclobutyl]triazole-4-carboxylic acid. InChIKey: IWVIOFLJAJWRNW-PHDIDXHHSA-N.

Identity
Molecular formulaC7H9N3O3
Molecular weight183.16 g/mol
IUPAC name1-[(1R,2R)-2-hydroxycyclobutyl]triazole-4-carboxylic acid
InChIKeyIWVIOFLJAJWRNW-PHDIDXHHSA-N
SMILESC1C[C@H]([C@@H]1N2C=C(N=N2)C(=O)O)O

Computed by PubChem (NCBI)