Products 2044714-23-8
CAS 2044714-23-8 is the registry number for 3a,6a-Dimethyl-octahydropyrrolo(3,4-c)pyrrole-1,3-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3a,6a-dimethyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione;hydrochloride (CAS 2044714-23-8) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: 3a,6a-dimethyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione;hydrochloride. InChIKey: QASMCXMASYILIO-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 3a,6a-dimethyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione;hydrochloride |
| InChIKey | QASMCXMASYILIO-UHFFFAOYSA-N |
| SMILES | CC12CNCC1(C(=O)NC2=O)C.Cl |
Computed by PubChem (NCBI)