CAS 20492-07-3 is the registry number for 2-(Furan-2-yl)-4H-benzo[d][1,3]oxazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(furan-2-yl)-3,1-benzoxazin-4-one (CAS 20492-07-3) is a chemical compound with the molecular formula C12H7NO3 and a molecular weight of 213.19 g/mol. IUPAC name: 2-(furan-2-yl)-3,1-benzoxazin-4-one. InChIKey: UUKJKGJWLSRNNK-UHFFFAOYSA-N.
| Molecular formula | C12H7NO3 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-(furan-2-yl)-3,1-benzoxazin-4-one |
| InChIKey | UUKJKGJWLSRNNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC(=N2)C3=CC=CO3 |
Computed by PubChem (NCBI)