Products 61035-49-2

CAS 61035-49-2 is the registry number for 2-Oxo-1,2-dihydrobenzo[cd]indole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-oxo-1H-benzo[cd]indole-5-carboxylic acid (CAS 61035-49-2) is a chemical compound with the molecular formula C12H7NO3 and a molecular weight of 213.19 g/mol. IUPAC name: 2-oxo-1H-benzo[cd]indole-5-carboxylic acid. InChIKey: YRIRFESPCZAHEW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7NO3
Molecular weight213.19 g/mol
IUPAC name2-oxo-1H-benzo[cd]indole-5-carboxylic acid
InChIKeyYRIRFESPCZAHEW-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC3=C2C(=C1)NC3=O)C(=O)O

Computed by PubChem (NCBI)