CAS 6492-86-0 appears in our catalog under these names: 6-Aminobenzo[de]isochromene-1,3-dione 95%, 4-Amino-1,8-naphthalenedicarboxylic anhydride, 95%, 95%, 4-AMINO-1,8-NAPHTHALIC ANHYDRIDE, 95%, 6-Aminobenzo[de]isochromene-1,3-dione, 95%. Offered by: Ambeed, Chemat, Sigma-Aldrich, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
8-amino-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 6492-86-0) is a chemical compound with the molecular formula C12H7NO3 and a molecular weight of 213.19 g/mol. IUPAC name: 8-amino-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: QIXHMCMCFSNKOG-UHFFFAOYSA-N.
| Molecular formula | C12H7NO3 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 8-amino-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | QIXHMCMCFSNKOG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)OC3=O)N |
Computed by PubChem (NCBI)