CAS 5963-89-3 is the registry number for 2-Oxo-1,2-dihydrobenzo[cd]indole-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxo-1H-benzo[cd]indole-6-carboxylic acid (CAS 5963-89-3) is a chemical compound with the molecular formula C12H7NO3 and a molecular weight of 213.19 g/mol. IUPAC name: 2-oxo-1H-benzo[cd]indole-6-carboxylic acid. InChIKey: BTZHDFSXIDMQOH-UHFFFAOYSA-N.
| Molecular formula | C12H7NO3 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-oxo-1H-benzo[cd]indole-6-carboxylic acid |
| InChIKey | BTZHDFSXIDMQOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)N3)C(=O)O |
Computed by PubChem (NCBI)