CAS 87812-99-5 is the registry number for 1-Nitrodibenzo[b,d]furan, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-nitrodibenzofuran (CAS 87812-99-5) is a chemical compound with the molecular formula C12H7NO3 and a molecular weight of 213.19 g/mol. IUPAC name: 1-nitrodibenzofuran. InChIKey: AMKYSWHDHALJOT-UHFFFAOYSA-N.
| Molecular formula | C12H7NO3 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 1-nitrodibenzofuran |
| InChIKey | AMKYSWHDHALJOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC=C3O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)