CAS 20927-95-1 is the registry number for 2-Nitrodibenzo[b,d]furan, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-nitrodibenzofuran (CAS 20927-95-1) is a chemical compound with the molecular formula C12H7NO3 and a molecular weight of 213.19 g/mol. IUPAC name: 2-nitrodibenzofuran. InChIKey: YPFPLEUXZNAAEE-UHFFFAOYSA-N.
| Molecular formula | C12H7NO3 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-nitrodibenzofuran |
| InChIKey | YPFPLEUXZNAAEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)