CAS 2050057-64-0 appears in our catalog under these names: 1,5-Bis(5-hydroxy-2-methylphenyl)pentan-3-one 98%, 1,5-Bis(5-hydroxy-2-methylphenyl)pentan-3-one, 98%, 98%, 1,5-Bis(5-hydroxy-2-methylphenyl)pentan-3-one, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g.
1,5-bis(5-hydroxy-2-methylphenyl)pentan-3-one (CAS 2050057-64-0) is a chemical compound with the molecular formula C19H22O3 and a molecular weight of 298.4 g/mol. IUPAC name: 1,5-bis(5-hydroxy-2-methylphenyl)pentan-3-one. InChIKey: JQSGJKMKNAOSMA-UHFFFAOYSA-N.
| Molecular formula | C19H22O3 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 1,5-bis(5-hydroxy-2-methylphenyl)pentan-3-one |
| InChIKey | JQSGJKMKNAOSMA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)O)CCC(=O)CCC2=C(C=CC(=C2)O)C |
Computed by PubChem (NCBI)