CAS 205445-56-3 appears in our catalog under these names: (R)–2–((tert–Butoxycarbonyl)amino)–3–(3–cyanophenyl)propanoic acid, (R)-2-((tert-Butoxycarbonyl)amino)-3-(3-cyanophenyl)propanoic acid, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
(2R)-3-(3-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 205445-56-3) is a chemical compound with the molecular formula C15H18N2O4 and a molecular weight of 290.31 g/mol. IUPAC name: (2R)-3-(3-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: FDQDHMZKOPOWFE-GFCCVEGCSA-N.
| Molecular formula | C15H18N2O4 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | (2R)-3-(3-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | FDQDHMZKOPOWFE-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)