CAS 2055841-95-5 appears in our catalog under these names: 5-[(1S,2S)-Rel-2-aminocyclopropyl]thiophene-2-carboxylic acid hydrochloride, 95%, rel-5-((1S,2S)-2-Aminocyclopropyl)thiophene-2-carboxylic acid hydrochloride, 97%, 5-[(1S,2S)-rel-2-aminocyclopropyl]thiophene-2-carboxylic acid hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg.
5-[(1S,2S)-2-aminocyclopropyl]thiophene-2-carboxylic acid;hydrochloride (CAS 2055841-95-5) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: 5-[(1S,2S)-2-aminocyclopropyl]thiophene-2-carboxylic acid;hydrochloride. InChIKey: PMSJXGPYKIGQAA-FHAQVOQBSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 5-[(1S,2S)-2-aminocyclopropyl]thiophene-2-carboxylic acid;hydrochloride |
| InChIKey | PMSJXGPYKIGQAA-FHAQVOQBSA-N |
| SMILES | C1[C@@H]([C@H]1N)C2=CC=C(S2)C(=O)O.Cl |
Computed by PubChem (NCBI)