Products 2058056-41-8
CAS 2058056-41-8 is the registry number for 1-Hydroxy-3,4-dihydro-1H-benzo[c][1,2]oxaborinine-7-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1-hydroxy-3,4-dihydro-2,1-benzoxaborinine-7-carboxylic acid (CAS 2058056-41-8) is a chemical compound with the molecular formula C9H9BO4 and a molecular weight of 191.98 g/mol. IUPAC name: 1-hydroxy-3,4-dihydro-2,1-benzoxaborinine-7-carboxylic acid. InChIKey: JZOQOFXGLYVVJF-UHFFFAOYSA-N.
| Molecular formula | C9H9BO4 |
|---|---|
| Molecular weight | 191.98 g/mol |
| IUPAC name | 1-hydroxy-3,4-dihydro-2,1-benzoxaborinine-7-carboxylic acid |
| InChIKey | JZOQOFXGLYVVJF-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CCO1)C=CC(=C2)C(=O)O)O |
Computed by PubChem (NCBI)