CAS 20587-30-8 appears in our catalog under these names: Methyl 5–methyl–2–nitrobenzoate, Methyl 5-Methyl-2-nitrobenzoate, >98.0%(GC), Methyl 5-methyl-2-nitrobenzoate 98%, Methyl 5-methyl-2-nitrobenzoate, 98%, 98%, METHYL 5-METHYL-2-NITROBENZOATE, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 5g, 25g, 10g, 500g.
Methyl 5-methyl-2-nitrobenzoate (CAS 20587-30-8) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: methyl 5-methyl-2-nitrobenzoate. InChIKey: KFOICDVZQKFCGM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | methyl 5-methyl-2-nitrobenzoate |
| InChIKey | KFOICDVZQKFCGM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)