CAS 2059910-53-9 is the registry number for (1S,3s)-1-(3,5-difluorophenyl)-3-hydroxycyclobutane-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(3,5-difluorophenyl)-3-hydroxycyclobutane-1-carboxylic acid (CAS 2059910-53-9) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: 1-(3,5-difluorophenyl)-3-hydroxycyclobutane-1-carboxylic acid. InChIKey: LIJUKIGAKGDVJW-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)-3-hydroxycyclobutane-1-carboxylic acid |
| InChIKey | LIJUKIGAKGDVJW-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C2=CC(=CC(=C2)F)F)C(=O)O)O |
Computed by PubChem (NCBI)