CAS 2059917-37-0 is the registry number for (2R,4R,6S)-1-((tert-butoxy)carbonyl)-2,6-dimethylpiperidine-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R,6S)-2,6-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 2059917-37-0) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: (2R,6S)-2,6-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: KFLWOWNEKVAXJD-ULKQDVFKSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (2R,6S)-2,6-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | KFLWOWNEKVAXJD-ULKQDVFKSA-N |
| SMILES | C[C@@H]1CC(C[C@@H](N1C(=O)OC(C)(C)C)C)C(=O)O |
Computed by PubChem (NCBI)