CAS 2060044-01-9 is the registry number for 1-(2-(tert-Butoxy)-2-oxoethyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]triazole-4-carboxylic acid (CAS 2060044-01-9) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]triazole-4-carboxylic acid. InChIKey: IDSLWWYZOCVGHA-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]triazole-4-carboxylic acid |
| InChIKey | IDSLWWYZOCVGHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1C=C(N=N1)C(=O)O |
Computed by PubChem (NCBI)