CAS 206055-90-5 appears in our catalog under these names: (3–(4–Chlorophenyl)isoxazol–5–yl)methanol, (3-(4-Chlorophenyl)isoxazol-5-yl)methanol, ≥95%, ≥95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methanol (CAS 206055-90-5) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methanol. InChIKey: YJIXYDFXXAWEMH-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methanol |
| InChIKey | YJIXYDFXXAWEMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)CO)Cl |
Computed by PubChem (NCBI)