Products 206066-05-9
CAS 206066-05-9 is the registry number for Methyl 3-nitro-4-(2-oxopropyl)benzoate, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-nitro-4-(2-oxopropyl)benzoate (CAS 206066-05-9) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: methyl 3-nitro-4-(2-oxopropyl)benzoate. InChIKey: KNRQPSPRSWUTAM-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | methyl 3-nitro-4-(2-oxopropyl)benzoate |
| InChIKey | KNRQPSPRSWUTAM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=C(C=C(C=C1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)