Products 2061996-45-8
CAS 2061996-45-8 appears in our catalog under these names: (S)-2-Amino-2-(3-(methoxymethyl)phenyl)ethanol hydrochloride, 95%, (S)–2–Amino–2–(3–(methoxymethyl)phenyl)ethanol hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
(2S)-2-amino-2-[3-(methoxymethyl)phenyl]ethanol;hydrochloride (CAS 2061996-45-8) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (2S)-2-amino-2-[3-(methoxymethyl)phenyl]ethanol;hydrochloride. InChIKey: ILHVCMCBBBKUNY-HNCPQSOCSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (2S)-2-amino-2-[3-(methoxymethyl)phenyl]ethanol;hydrochloride |
| InChIKey | ILHVCMCBBBKUNY-HNCPQSOCSA-N |
| SMILES | COCC1=CC(=CC=C1)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)