CAS 2065249-96-7 appears in our catalog under these names: 2-Amino-4-methoxy-nicotinic acid methyl ester, 95%, Methyl 2-amino-4-methoxynicotinate, 98%, 2-Amino-4-methoxy-nicotinic acid methyl ester, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg.
Methyl 2-amino-4-methoxypyridine-3-carboxylate (CAS 2065249-96-7) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: methyl 2-amino-4-methoxypyridine-3-carboxylate. InChIKey: VIEWQOMIQYTQEN-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | methyl 2-amino-4-methoxypyridine-3-carboxylate |
| InChIKey | VIEWQOMIQYTQEN-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC=C1)N)C(=O)OC |
Computed by PubChem (NCBI)