Products 20655-58-7

CAS 20655-58-7 is the registry number for Ethyl 3–(4–cyanophenyl)acrylate. Offered by: GLPBio. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-(4-cyanophenyl)prop-2-enoate (CAS 20655-58-7) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: ethyl 3-(4-cyanophenyl)prop-2-enoate. InChIKey: NVLBOCIUMFYPGI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO2
Molecular weight201.22 g/mol
IUPAC nameethyl 3-(4-cyanophenyl)prop-2-enoate
InChIKeyNVLBOCIUMFYPGI-UHFFFAOYSA-N
SMILESCCOC(=O)C=CC1=CC=C(C=C1)C#N

Computed by PubChem (NCBI)