CAS 207300-83-2 appears in our catalog under these names: (S)-2-(2-Aminoacetamido)-3-(4-hydroxyphenyl)propanoic acid hydrate, 95%, (2S)-2-(2-aminoacetamido)-3-(4-hydroxyphenyl)propanoic acid hydrate, 98.0%, 98.0%, H–Gly–Tyr–OH Hydrate, Glycyl-L-tyrosine Hydrate, >98.0%(T). Offered by: Fluorochem, Chemat, GLPBio, TCI. Available pack sizes: 1g, 5g, 250mg.
(2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoic acid;hydrate (CAS 207300-83-2) is a chemical compound with the molecular formula C11H16N2O5 and a molecular weight of 256.25 g/mol. IUPAC name: (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoic acid;hydrate. InChIKey: HWTGMUQZDXXXDC-FVGYRXGTSA-N.
| Molecular formula | C11H16N2O5 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoic acid;hydrate |
| InChIKey | HWTGMUQZDXXXDC-FVGYRXGTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)NC(=O)CN)O.O |
Computed by PubChem (NCBI)