CAS 2079878-75-2 is the registry number for 2–(2–Chlorophenyl)–2–nitrocyclohexanone. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
2-(2-chlorophenyl)-2-nitrocyclohexan-1-one (CAS 2079878-75-2) is a chemical compound with the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-nitrocyclohexan-1-one. InChIKey: OBRSWNBWMZPYHU-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO3 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-2-nitrocyclohexan-1-one |
| InChIKey | OBRSWNBWMZPYHU-UHFFFAOYSA-N |
| SMILES | C1CCC(C(=O)C1)(C2=CC=CC=C2Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)