Products 20811-81-8
CAS 20811-81-8 is the registry number for 3-Amino-6-chloro-3,4-dihydro-2H-1-benzopyran-4-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-amino-6-chloro-2,3-dihydrochromen-4-one;hydrochloride (CAS 20811-81-8) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 3-amino-6-chloro-2,3-dihydrochromen-4-one;hydrochloride. InChIKey: NMWWRXIIXOZPRR-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 3-amino-6-chloro-2,3-dihydrochromen-4-one;hydrochloride |
| InChIKey | NMWWRXIIXOZPRR-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)C2=C(O1)C=CC(=C2)Cl)N.Cl |
Computed by PubChem (NCBI)