CAS 20844-48-8 appears in our catalog under these names: 3-(3-Nitrophenyl)-5-phenyl-1,2,4-oxadiazole, 98%, 3–(3–Nitrophenyl)–5–phenyl–1,2,4–oxadiazole, 3-(3-Nitrophenyl)-5-phenyl-1,2,4-oxadiazole. Offered by: Combi-blocks, GLPBio, MedChemExpress. Available pack sizes: 25g, 1g, 100g, 5g, Get quote.
3-(3-nitrophenyl)-5-phenyl-1,2,4-oxadiazole (CAS 20844-48-8) is a chemical compound with the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. IUPAC name: 3-(3-nitrophenyl)-5-phenyl-1,2,4-oxadiazole. InChIKey: MEANKDBJCLROEM-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O3 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 3-(3-nitrophenyl)-5-phenyl-1,2,4-oxadiazole |
| InChIKey | MEANKDBJCLROEM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NO2)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)