CAS 23856-15-7 is the registry number for 1–benzoyl–5–nitroindazole. Offered by: GLPBio. Available pack sizes: 200mg.
(5-nitroindazol-1-yl)-phenylmethanone (CAS 23856-15-7) is a chemical compound with the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. IUPAC name: (5-nitroindazol-1-yl)-phenylmethanone. InChIKey: YOHMDFWMHMUDDT-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O3 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | (5-nitroindazol-1-yl)-phenylmethanone |
| InChIKey | YOHMDFWMHMUDDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N2C3=C(C=C(C=C3)[N+](=O)[O-])C=N2 |
Computed by PubChem (NCBI)