CAS 904053-04-9 is the registry number for 6-(4-Acetylphenyl)-5h-pyrrolo[3,4-b]pyrazine-5,7(6h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
6-(4-acetylphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione (CAS 904053-04-9) is a chemical compound with the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. IUPAC name: 6-(4-acetylphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione. InChIKey: YGJLHFLSOFVVNX-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O3 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 6-(4-acetylphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione |
| InChIKey | YGJLHFLSOFVVNX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2C(=O)C3=NC=CN=C3C2=O |
Computed by PubChem (NCBI)