CAS 36567-87-0 appears in our catalog under these names: 2-(2-Nitrophenyl)quinazolin-4(3h)-one, 95%, 2–(2–Nitrophenyl)quinazolin–4(3H)–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-(2-nitrophenyl)-3H-quinazolin-4-one (CAS 36567-87-0) is a chemical compound with the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. IUPAC name: 2-(2-nitrophenyl)-3H-quinazolin-4-one. InChIKey: XRUALMVDXOBYSP-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O3 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 2-(2-nitrophenyl)-3H-quinazolin-4-one |
| InChIKey | XRUALMVDXOBYSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)